C17H21ClN2OS2 — CID 119426390
N-piperidin-3-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride (PubChem CID 119426390) has the molecular formula C17H21ClN2OS2 and a molecular weight of 368.96 g/mol. Its IUPAC name is N-piperidin-3-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride.
| Compound Name | N-piperidin-3-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119426390 |
| Molecular Formula | C17H21ClN2OS2 |
| Molecular Weight | 368.96 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-piperidin-3-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C17H20N2OS2.ClH/c20-17(19-13-5-3-9-18-11-13)15-7-1-2-8-16(15)22-12-14-6-4-10-21-14;/h1-2,4,6-8,10,13,18H,3,5,9,11-12H2,(H,19,20);1H |
| InChIKey | AOTYAAZKNCYLSV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |