C23H23FN2OS — CID 91950349
[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(thiophen-2-ylmethyl)phenyl]methanone (PubChem CID 91950349) has the molecular formula C23H23FN2OS and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(thiophen-2-ylmethyl)phenyl]methanone.
| Compound Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(thiophen-2-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 91950349 |
| Molecular Formula | C23H23FN2OS |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(thiophen-2-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1Cc1cccs1)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H23FN2OS/c24-20-9-7-18(8-10-20)17-25-11-13-26(14-12-25)23(27)22-6-2-1-4-19(22)16-21-5-3-15-28-21/h1-10,15H,11-14,16-17H2 |
| InChIKey | PYYPDMVCCYVXQO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |