C21H22FNO4 — CID 51153897
methyl 1-[2-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate (PubChem CID 51153897) has the molecular formula C21H22FNO4 and a molecular weight of 371.41 g/mol. Its IUPAC name is methyl 1-[2-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51153897 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl 1-[2-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccccc2OCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22FNO4/c1-26-21(25)16-10-12-23(13-11-16)20(24)18-4-2-3-5-19(18)27-14-15-6-8-17(22)9-7-15/h2-9,16H,10-14H2,1H3 |
| InChIKey | GICZVZJMMRGXBG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |