C33H42N6O2 — CID 11364931
1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-tert-butylurea (PubChem CID 11364931) has the molecular formula C33H42N6O2 and a molecular weight of 554.74 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-tert-butylurea.
| Compound Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 11364931 |
| Molecular Formula | C33H42N6O2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)Nc1cc(C(=O)N2CCNCC2)ccc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H42N6O2/c1-33(2,3)36-32(41)35-28-24-27(31(40)39-18-16-34-17-19-39)14-15-29(28)37-20-22-38(23-21-37)30(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-15,24,30,34H,16-23H2,1-3H3,(H2,35,36,41) |
| InChIKey | FOZPXJCUXQNTDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |