C13H14FN3O4 — CID 61202693
3-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-4-fluorobenzoic acid (PubChem CID 61202693) has the molecular formula C13H14FN3O4 and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-4-fluorobenzoic acid.
| Compound Name | 3-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 61202693 |
| Molecular Formula | C13H14FN3O4 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-4-fluorobenzoic acid |
| SMILES | O=C(CNC(=O)Nc1cc(C(=O)O)ccc1F)NC1CC1 |
| InChI | InChI=1S/C13H14FN3O4/c14-9-4-1-7(12(19)20)5-10(9)17-13(21)15-6-11(18)16-8-2-3-8/h1,4-5,8H,2-3,6H2,(H,16,18)(H,19,20)(H2,15,17,21) |
| InChIKey | UYGZFANHICRVMH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |