C13H15N3O5 — CID 61202694
4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-3-hydroxybenzoic acid (PubChem CID 61202694) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-3-hydroxybenzoic acid.
| Compound Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61202694 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-3-hydroxybenzoic acid |
| SMILES | O=C(CNC(=O)Nc1ccc(C(=O)O)cc1O)NC1CC1 |
| InChI | InChI=1S/C13H15N3O5/c17-10-5-7(12(19)20)1-4-9(10)16-13(21)14-6-11(18)15-8-2-3-8/h1,4-5,8,17H,2-3,6H2,(H,15,18)(H,19,20)(H2,14,16,21) |
| InChIKey | OJOXTADYBPMBOO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|