C13H17N3O5 — CID 61201369
3-hydroxy-4-[[2-oxo-2-(propylamino)ethyl]carbamoylamino]benzoic acid (PubChem CID 61201369) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-oxo-2-(propylamino)ethyl]carbamoylamino]benzoic acid.
| Compound Name | 3-hydroxy-4-[[2-oxo-2-(propylamino)ethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 61201369 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-hydroxy-4-[[2-oxo-2-(propylamino)ethyl]carbamoylamino]benzoic acid |
| SMILES | CCCNC(=O)CNC(=O)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C13H17N3O5/c1-2-5-14-11(18)7-15-13(21)16-9-4-3-8(12(19)20)6-10(9)17/h3-4,6,17H,2,5,7H2,1H3,(H,14,18)(H,19,20)(H2,15,16,21) |
| InChIKey | QNPUNMULKXIAQV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|