C17H26FN3O3 — CID 174569625
tert-butyl formate;1-(4-fluorophenyl)-3-piperidin-4-ylurea (PubChem CID 174569625) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is tert-butyl formate;1-(4-fluorophenyl)-3-piperidin-4-ylurea.
| Compound Name | tert-butyl formate;1-(4-fluorophenyl)-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 174569625 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl formate;1-(4-fluorophenyl)-3-piperidin-4-ylurea |
| SMILES | CC(C)(C)OC=O.O=C(Nc1ccc(F)cc1)NC1CCNCC1 |
| InChI | InChI=1S/C12H16FN3O.C5H10O2/c13-9-1-3-10(4-2-9)15-12(17)16-11-5-7-14-8-6-11;1-5(2,3)7-4-6/h1-4,11,14H,5-8H2,(H2,15,16,17);4H,1-3H3 |
| InChIKey | WVTDZIIIXRWSNT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|