C14H20ClN3O4S — CID 156583823
1-(4-chlorophenyl)-3-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]urea (PubChem CID 156583823) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]urea |
|---|---|
| PubChem CID | 156583823 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]urea |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClN3O4S/c1-18(2)23(20,21)9-10-7-22-8-13(10)17-14(19)16-12-5-3-11(15)4-6-12/h3-6,10,13H,7-9H2,1-2H3,(H2,16,17,19)/t10-,13-/m0/s1 |
| InChIKey | ZOAHKWNMCYTJQX-GWCFXTLKSA-N |
| XLogP | 1.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |