C14H18Cl2N2O4S — CID 135088948
3,4-dichloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzamide (PubChem CID 135088948) has the molecular formula C14H18Cl2N2O4S and a molecular weight of 381.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 135088948 |
| Molecular Formula | C14H18Cl2N2O4S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 3,4-dichloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O4S/c1-18(2)23(20,21)8-10-6-22-7-13(10)17-14(19)9-3-4-11(15)12(16)5-9/h3-5,10,13H,6-8H2,1-2H3,(H,17,19)/t10-,13-/m0/s1 |
| InChIKey | GKJMAOWAWRKPMG-GWCFXTLKSA-N |
| XLogP | 1.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |