C14H21N3O6S2 — CID 163312504
N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-sulfamoylbenzamide (PubChem CID 163312504) has the molecular formula C14H21N3O6S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-sulfamoylbenzamide.
| Compound Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 163312504 |
| Molecular Formula | C14H21N3O6S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-4-sulfamoylbenzamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O6S2/c1-17(2)24(19,20)9-11-7-23-8-13(11)16-14(18)10-3-5-12(6-4-10)25(15,21)22/h3-6,11,13H,7-9H2,1-2H3,(H,16,18)(H2,15,21,22)/t11-,13+/m0/s1 |
| InChIKey | MMDMZBAYRGPVKW-WCQYABFASA-N |
| XLogP | -1.03 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |