C14H20N2O5S — CID 135111757
N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-3-hydroxybenzamide (PubChem CID 135111757) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-3-hydroxybenzamide.
| Compound Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 135111757 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-3-hydroxybenzamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H20N2O5S/c1-16(2)22(19,20)9-11-7-21-8-13(11)15-14(18)10-4-3-5-12(17)6-10/h3-6,11,13,17H,7-9H2,1-2H3,(H,15,18)/t11-,13-/m0/s1 |
| InChIKey | SFRQNUWRFYNBSM-AAEUAGOBSA-N |
| XLogP | 0.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |