C16H21N3O4S — CID 135088303
N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide (PubChem CID 135088303) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135088303 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H21N3O4S/c1-19(2)24(21,22)10-12-8-23-9-15(12)18-16(20)14-7-11-5-3-4-6-13(11)17-14/h3-7,12,15,17H,8-10H2,1-2H3,(H,18,20)/t12-,15+/m0/s1 |
| InChIKey | OYGGWYDFWVWKTK-SWLSCSKDSA-N |
| XLogP | 0.80 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |