C15H22N2O5S — CID 135108936
N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-methoxybenzamide (PubChem CID 135108936) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-methoxybenzamide.
| Compound Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 135108936 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N[C@H]1COC[C@H]1CS(=O)(=O)N(C)C |
| InChI | InChI=1S/C15H22N2O5S/c1-17(2)23(19,20)10-11-8-22-9-13(11)16-15(18)12-6-4-5-7-14(12)21-3/h4-7,11,13H,8-10H2,1-3H3,(H,16,18)/t11-,13-/m0/s1 |
| InChIKey | SJMYWDXVNNVUPA-AAEUAGOBSA-N |
| XLogP | 0.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |