C14H18F2N2O4S — CID 135090773
N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2,4-difluorobenzamide (PubChem CID 135090773) has the molecular formula C14H18F2N2O4S and a molecular weight of 348.37 g/mol. Its IUPAC name is N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2,4-difluorobenzamide.
| Compound Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 135090773 |
| Molecular Formula | C14H18F2N2O4S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2,4-difluorobenzamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O4S/c1-18(2)23(20,21)8-9-6-22-7-13(9)17-14(19)11-4-3-10(15)5-12(11)16/h3-5,9,13H,6-8H2,1-2H3,(H,17,19)/t9-,13+/m0/s1 |
| InChIKey | RJZJYSFXVMFBCY-TVQRCGJNSA-N |
| XLogP | 0.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |