C13H19ClN2O5S2 — CID 135106288
3-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzenesulfonamide (PubChem CID 135106288) has the molecular formula C13H19ClN2O5S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 3-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135106288 |
| Molecular Formula | C13H19ClN2O5S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O5S2/c1-16(2)22(17,18)9-10-7-21-8-13(10)15-23(19,20)12-5-3-4-11(14)6-12/h3-6,10,13,15H,7-9H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | UITKJIRBQQCOBL-GWCFXTLKSA-N |
| XLogP | 0.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |