C19H19ClF3N3O6S — CID 147625287
2-[6-chloro-2-hydroxy-3-[[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]carbamoylamino]phenyl]sulfonyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 147625287) has the molecular formula C19H19ClF3N3O6S and a molecular weight of 509.89 g/mol. Its IUPAC name is 2-[6-chloro-2-hydroxy-3-[[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]carbamoylamino]phenyl]sulfonyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[6-chloro-2-hydroxy-3-[[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]carbamoylamino]phenyl]sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 147625287 |
| Molecular Formula | C19H19ClF3N3O6S |
| Molecular Weight | 509.89 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 2-[6-chloro-2-hydroxy-3-[[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]carbamoylamino]phenyl]sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1c(Cl)ccc(NC(=O)N[C@H]2CCCc3ccoc32)c1O)NCC(F)(F)F |
| InChI | InChI=1S/C19H19ClF3N3O6S/c20-11-4-5-12(25-18(29)26-13-3-1-2-10-6-7-32-16(10)13)15(28)17(11)33(30,31)8-14(27)24-9-19(21,22)23/h4-7,13,28H,1-3,8-9H2,(H,24,27)(H2,25,26,29)/t13-/m0/s1 |
| InChIKey | GEQQIDUWOAIIPF-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|