C13H15ClN2O4 — CID 28931571
5-[(3-chloro-2-methylphenyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 28931571) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 5-[(3-chloro-2-methylphenyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(3-chloro-2-methylphenyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 28931571 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-[(3-chloro-2-methylphenyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C13H15ClN2O4/c1-8-9(14)4-2-5-10(8)15-13(20)16-11(17)6-3-7-12(18)19/h2,4-5H,3,6-7H2,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | AQLMZNWIUHJZJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |