C15H11N6O3S+ — CID 7333902
2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 7333902) has the molecular formula C15H11N6O3S+ and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7333902 |
| Molecular Formula | C15H11N6O3S+ |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | N#Cc1cc(C#N)c(SCC(=O)Nc2cccc([N+](=O)[O-])c2)[nH+]c1N |
| InChI | InChI=1S/C15H10N6O3S/c16-6-9-4-10(7-17)15(20-14(9)18)25-8-13(22)19-11-2-1-3-12(5-11)21(23)24/h1-5H,8H2,(H2,18,20)(H,19,22)/p+1 |
| InChIKey | QVRXCUOACWHHTR-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|