C10H12N2O4S — CID 2938636
2-(2-hydroxyethylsulfanyl)-N-(3-nitrophenyl)acetamide (PubChem CID 2938636) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(2-hydroxyethylsulfanyl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2938636 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CSCCO)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O4S/c13-4-5-17-7-10(14)11-8-2-1-3-9(6-8)12(15)16/h1-3,6,13H,4-5,7H2,(H,11,14) |
| InChIKey | UDENOPONBLHTTB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|