C17H16Cl2N2O4S — CID 8798879
3-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 8798879) has the molecular formula C17H16Cl2N2O4S and a molecular weight of 415.30 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 8798879 |
| Molecular Formula | C17H16Cl2N2O4S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O4S/c1-25-16-5-3-12(21(23)24)9-15(16)20-17(22)6-7-26-10-11-2-4-13(18)14(19)8-11/h2-5,8-9H,6-7,10H2,1H3,(H,20,22) |
| InChIKey | CKWVYQNQGTZXRB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|