C16H26N4O4+2 — CID 5159522
3-(4-ethylpiperazine-1,4-diium-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 5159522) has the molecular formula C16H26N4O4+2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(4-ethylpiperazine-1,4-diium-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 3-(4-ethylpiperazine-1,4-diium-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 5159522 |
| Molecular Formula | C16H26N4O4+2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-(4-ethylpiperazine-1,4-diium-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | CC[NH+]1CC[NH+](CCC(=O)Nc2cc([N+](=O)[O-])ccc2OC)CC1 |
| InChI | InChI=1S/C16H24N4O4/c1-3-18-8-10-19(11-9-18)7-6-16(21)17-14-12-13(20(22)23)4-5-15(14)24-2/h4-5,12H,3,6-11H2,1-2H3,(H,17,21)/p+2 |
| InChIKey | LTOKIWVEJXTXCR-UHFFFAOYSA-P |
| XLogP | -1.26 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|