C15H18INO3S — CID 65443486
2-[1-[[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65443486) has the molecular formula C15H18INO3S and a molecular weight of 419.28 g/mol. Its IUPAC name is 2-[1-[[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443486 |
| Molecular Formula | C15H18INO3S |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 2-[1-[[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | Cc1cc(I)ccc1NC(=O)CSCC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H18INO3S/c1-10-6-11(16)2-3-12(10)17-13(18)8-21-9-15(4-5-15)7-14(19)20/h2-3,6H,4-5,7-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | COJARNGMHGMKIP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|