C18H14N2O7S — CID 7785472
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-oxochromene-3-carboxylate (PubChem CID 7785472) has the molecular formula C18H14N2O7S and a molecular weight of 402.38 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785472 |
| Molecular Formula | C18H14N2O7S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-oxochromene-3-carboxylate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C18H14N2O7S/c19-28(24,25)13-6-3-5-12(9-13)20-16(21)10-26-17(22)14-8-11-4-1-2-7-15(11)27-18(14)23/h1-9H,10H2,(H,20,21)(H2,19,24,25) |
| InChIKey | XEQIKOHYJIEULH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|