C15H19ClN2O6S — CID 119244235
(2R)-2-[[2-[(4-chlorobenzoyl)amino]-4-methylsulfonylbutanoyl]amino]propanoic acid (PubChem CID 119244235) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is (2R)-2-[[2-[(4-chlorobenzoyl)amino]-4-methylsulfonylbutanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[(4-chlorobenzoyl)amino]-4-methylsulfonylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119244235 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2R)-2-[[2-[(4-chlorobenzoyl)amino]-4-methylsulfonylbutanoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C(CCS(C)(=O)=O)NC(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H19ClN2O6S/c1-9(15(21)22)17-14(20)12(7-8-25(2,23)24)18-13(19)10-3-5-11(16)6-4-10/h3-6,9,12H,7-8H2,1-2H3,(H,17,20)(H,18,19)(H,21,22)/t9-,12?/m1/s1 |
| InChIKey | YFBGXJQCAABYJN-PKEIRNPWSA-N |
| XLogP | 0.46 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |