C16H24ClN3O4S — CID 119504716
4-chloro-N-[1-[2-(ethylamino)ethylamino]-4-methylsulfonyl-1-oxobutan-2-yl]benzamide (PubChem CID 119504716) has the molecular formula C16H24ClN3O4S and a molecular weight of 389.91 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-(ethylamino)ethylamino]-4-methylsulfonyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-(ethylamino)ethylamino]-4-methylsulfonyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 119504716 |
| Molecular Formula | C16H24ClN3O4S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-chloro-N-[1-[2-(ethylamino)ethylamino]-4-methylsulfonyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCNCCNC(=O)C(CCS(C)(=O)=O)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O4S/c1-3-18-9-10-19-16(22)14(8-11-25(2,23)24)20-15(21)12-4-6-13(17)7-5-12/h4-7,14,18H,3,8-11H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | DHMIGMHYUCSCCC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|