C11H15NO3S — CID 104939035
3,5-dihydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide (PubChem CID 104939035) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 104939035 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3,5-dihydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide |
| SMILES | CSCC(C)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-7(6-16-2)12-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,13-14H,6H2,1-2H3,(H,12,15) |
| InChIKey | GTDDJQYVONAUKY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |