C11H14ClNO3 — CID 107706110
N-(4-chlorobutan-2-yl)-3,5-dihydroxybenzamide (PubChem CID 107706110) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-3,5-dihydroxybenzamide.
| Compound Name | N-(4-chlorobutan-2-yl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107706110 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-3,5-dihydroxybenzamide |
| SMILES | CC(CCCl)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14ClNO3/c1-7(2-3-12)13-11(16)8-4-9(14)6-10(15)5-8/h4-7,14-15H,2-3H2,1H3,(H,13,16) |
| InChIKey | RCQNOPHIBNUDLB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|