C12H14Cl3NO — CID 114305934
3,5-dichloro-N-(5-chloropentan-2-yl)benzamide (PubChem CID 114305934) has the molecular formula C12H14Cl3NO and a molecular weight of 294.61 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-chloropentan-2-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(5-chloropentan-2-yl)benzamide |
|---|---|
| PubChem CID | 114305934 |
| Molecular Formula | C12H14Cl3NO |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 3,5-dichloro-N-(5-chloropentan-2-yl)benzamide |
| SMILES | CC(CCCCl)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14Cl3NO/c1-8(3-2-4-13)16-12(17)9-5-10(14)7-11(15)6-9/h5-8H,2-4H2,1H3,(H,16,17) |
| InChIKey | MWBNCURYTGGOHA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|