C12H15FN2O4 — CID 103941343
2-fluoro-4-hydroxy-N-[2-(2-methoxyethylamino)-2-oxoethyl]benzamide (PubChem CID 103941343) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-[2-(2-methoxyethylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-[2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 103941343 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-[2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)CNC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C12H15FN2O4/c1-19-5-4-14-11(17)7-15-12(18)9-3-2-8(16)6-10(9)13/h2-3,6,16H,4-5,7H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | WWNSKNHKXULUNJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|