C16H22F3N3O2 — CID 154844942
2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 154844942) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 154844942 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | CN1CCN(c2ccccc2C(=O)NCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-21-7-9-22(10-8-21)14-5-3-2-4-13(14)15(23)20-6-11-24-12-16(17,18)19/h2-5H,6-12H2,1H3,(H,20,23) |
| InChIKey | IQSYLAYKHOKACT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|