C21H24N4OS — CID 167821763
N-[2-(1,2-benzothiazol-3-yl)ethyl]-2-(4-methylpiperazin-1-yl)benzamide (PubChem CID 167821763) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-yl)ethyl]-2-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-yl)ethyl]-2-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 167821763 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-yl)ethyl]-2-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccccc2C(=O)NCCc2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C21H24N4OS/c1-24-12-14-25(15-13-24)19-8-4-2-7-17(19)21(26)22-11-10-18-16-6-3-5-9-20(16)27-23-18/h2-9H,10-15H2,1H3,(H,22,26) |
| InChIKey | TTWDXYKQRVAHJP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |