C17H21N3O — CID 63116817
5-amino-N-[2-(cyclohexen-1-yl)ethyl]-1H-indole-3-carboxamide (PubChem CID 63116817) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 5-amino-N-[2-(cyclohexen-1-yl)ethyl]-1H-indole-3-carboxamide.
| Compound Name | 5-amino-N-[2-(cyclohexen-1-yl)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63116817 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-amino-N-[2-(cyclohexen-1-yl)ethyl]-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2[nH]cc(C(=O)NCCC3=CCCCC3)c2c1 |
| InChI | InChI=1S/C17H21N3O/c18-13-6-7-16-14(10-13)15(11-20-16)17(21)19-9-8-12-4-2-1-3-5-12/h4,6-7,10-11,20H,1-3,5,8-9,18H2,(H,19,21) |
| InChIKey | IEWJKENEDYXPGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|