C15H19N3O3 — CID 64581541
ethyl 4-[(5-amino-1H-indole-3-carbonyl)amino]butanoate (PubChem CID 64581541) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 4-[(5-amino-1H-indole-3-carbonyl)amino]butanoate.
| Compound Name | ethyl 4-[(5-amino-1H-indole-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 64581541 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | ethyl 4-[(5-amino-1H-indole-3-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C15H19N3O3/c1-2-21-14(19)4-3-7-17-15(20)12-9-18-13-6-5-10(16)8-11(12)13/h5-6,8-9,18H,2-4,7,16H2,1H3,(H,17,20) |
| InChIKey | BMXAXRQMXAYWTC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|