C20H31N3O4S — CID 42926952
N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(dimethylsulfamoyl)-4-methoxyanilino]propanamide (PubChem CID 42926952) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(dimethylsulfamoyl)-4-methoxyanilino]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(dimethylsulfamoyl)-4-methoxyanilino]propanamide |
|---|---|
| PubChem CID | 42926952 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(dimethylsulfamoyl)-4-methoxyanilino]propanamide |
| SMILES | COc1ccc(NC(C)C(=O)NCCC2=CCCCC2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H31N3O4S/c1-15(20(24)21-13-12-16-8-6-5-7-9-16)22-17-10-11-18(27-4)19(14-17)28(25,26)23(2)3/h8,10-11,14-15,22H,5-7,9,12-13H2,1-4H3,(H,21,24) |
| InChIKey | ATWTTYGGHOXHKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|