C27H32N2O4S — CID 43891209
N-(2-ethylphenyl)-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43891209) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-(2-ethylphenyl)-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43891209 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-(2-ethylphenyl)-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCc1ccccc1NC(=O)C(Cc1ccccc1)NS(=O)(=O)c1cc(C(C)C)ccc1OC |
| InChI | InChI=1S/C27H32N2O4S/c1-5-21-13-9-10-14-23(21)28-27(30)24(17-20-11-7-6-8-12-20)29-34(31,32)26-18-22(19(2)3)15-16-25(26)33-4/h6-16,18-19,24,29H,5,17H2,1-4H3,(H,28,30) |
| InChIKey | JQQNEDGEPQILBJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |