C30H36N2O6S — CID 43891282
butyl 4-[[2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoate (PubChem CID 43891282) has the molecular formula C30H36N2O6S and a molecular weight of 552.69 g/mol. Its IUPAC name is butyl 4-[[2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 43891282 |
| Molecular Formula | C30H36N2O6S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | butyl 4-[[2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Cc2ccccc2)NS(=O)(=O)c2cc(C(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C30H36N2O6S/c1-5-6-18-38-30(34)23-12-15-25(16-13-23)31-29(33)26(19-22-10-8-7-9-11-22)32-39(35,36)28-20-24(21(2)3)14-17-27(28)37-4/h7-17,20-21,26,32H,5-6,18-19H2,1-4H3,(H,31,33) |
| InChIKey | QKEHHXXHLBGFRG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|