C21H29ClN2O5S2 — CID 25338442
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 25338442) has the molecular formula C21H29ClN2O5S2 and a molecular weight of 489.06 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 25338442 |
| Molecular Formula | C21H29ClN2O5S2 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H29ClN2O5S2/c1-30-14-12-19(24-31(27,28)18-9-7-17(22)8-10-18)21(26)29-15-20(25)23-13-11-16-5-3-2-4-6-16/h5,7-10,19,24H,2-4,6,11-15H2,1H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | WJPOKPHGLZFNGF-LJQANCHMSA-N |
| XLogP | 3.29 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|