C17H27N3O4S — CID 119513298
2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(pyrrolidin-2-ylmethyl)butanamide (PubChem CID 119513298) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(pyrrolidin-2-ylmethyl)butanamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(pyrrolidin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 119513298 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(pyrrolidin-2-ylmethyl)butanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C(=O)NCC2CCCN2)C(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O4S/c1-12(2)16(17(21)19-11-13-5-4-10-18-13)20-25(22,23)15-8-6-14(24-3)7-9-15/h6-9,12-13,16,18,20H,4-5,10-11H2,1-3H3,(H,19,21) |
| InChIKey | POKHRTRFEHJRBQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |