C18H29N3O4S — CID 119536771
2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(2-pyrrolidin-3-ylethyl)butanamide (PubChem CID 119536771) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(2-pyrrolidin-3-ylethyl)butanamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(2-pyrrolidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119536771 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-(2-pyrrolidin-3-ylethyl)butanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C(=O)NCCC2CCNC2)C(C)C)cc1 |
| InChI | InChI=1S/C18H29N3O4S/c1-13(2)17(18(22)20-11-9-14-8-10-19-12-14)21-26(23,24)16-6-4-15(25-3)5-7-16/h4-7,13-14,17,19,21H,8-12H2,1-3H3,(H,20,22) |
| InChIKey | QOCPBENYFNIZKZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |