C20H31N3O5S — CID 55939568
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-(2-methylcyclohexyl)oxyethyl]propanamide (PubChem CID 55939568) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-(2-methylcyclohexyl)oxyethyl]propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-(2-methylcyclohexyl)oxyethyl]propanamide |
|---|---|
| PubChem CID | 55939568 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-(2-methylcyclohexyl)oxyethyl]propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCOC2CCCCC2C)cc1 |
| InChI | InChI=1S/C20H31N3O5S/c1-14-6-4-5-7-19(14)28-13-12-21-20(25)15(2)23-29(26,27)18-10-8-17(9-11-18)22-16(3)24/h8-11,14-15,19,23H,4-7,12-13H2,1-3H3,(H,21,25)(H,22,24)/t14?,15-,19?/m0/s1 |
| InChIKey | YNXIEHVQGKRPBC-HVEKOLDVSA-N |
| XLogP | 2.02 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|