C18H18F4N2O4S — CID 37361314
(2S)-N-[2-(4-fluorophenoxy)ethyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 37361314) has the molecular formula C18H18F4N2O4S and a molecular weight of 434.41 g/mol. Its IUPAC name is (2S)-N-[2-(4-fluorophenoxy)ethyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | (2S)-N-[2-(4-fluorophenoxy)ethyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 37361314 |
| Molecular Formula | C18H18F4N2O4S |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2S)-N-[2-(4-fluorophenoxy)ethyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F4N2O4S/c1-12(17(25)23-10-11-28-14-8-6-13(19)7-9-14)24-29(26,27)16-5-3-2-4-15(16)18(20,21)22/h2-9,12,24H,10-11H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | KNAJDEVPXXMYPI-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|