C20H23F4N3O3S — CID 55953589
(2S)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 55953589) has the molecular formula C20H23F4N3O3S and a molecular weight of 461.48 g/mol. Its IUPAC name is (2S)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | (2S)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55953589 |
| Molecular Formula | C20H23F4N3O3S |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)NCCCN(C)c1ccccc1F |
| InChI | InChI=1S/C20H23F4N3O3S/c1-14(26-31(29,30)18-11-6-3-8-15(18)20(22,23)24)19(28)25-12-7-13-27(2)17-10-5-4-9-16(17)21/h3-6,8-11,14,26H,7,12-13H2,1-2H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | GNZUTVYYOBZNLX-AWEZNQCLSA-N |
| XLogP | 3.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|