C17H21BrN2O4S — CID 4157844
3-[(4-bromophenyl)sulfonylamino]-N-butan-2-yl-3-(furan-2-yl)propanamide (PubChem CID 4157844) has the molecular formula C17H21BrN2O4S and a molecular weight of 429.34 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-butan-2-yl-3-(furan-2-yl)propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-butan-2-yl-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 4157844 |
| Molecular Formula | C17H21BrN2O4S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-butan-2-yl-3-(furan-2-yl)propanamide |
| SMILES | CCC(C)NC(=O)CC(NS(=O)(=O)c1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C17H21BrN2O4S/c1-3-12(2)19-17(21)11-15(16-5-4-10-24-16)20-25(22,23)14-8-6-13(18)7-9-14/h4-10,12,15,20H,3,11H2,1-2H3,(H,19,21) |
| InChIKey | MUQKIDQGBLJROC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |