C24H34N2O4S — CID 98363690
(3S)-N-heptyl-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 98363690) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is (3S)-N-heptyl-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | (3S)-N-heptyl-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 98363690 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (3S)-N-heptyl-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | CCCCCCCNC(=O)C[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-4-5-6-7-8-17-25-24(27)18-23(20-11-13-21(30-3)14-12-20)26-31(28,29)22-15-9-19(2)10-16-22/h9-16,23,26H,4-8,17-18H2,1-3H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | PCHGYLLDFKXOLJ-QHCPKHFHSA-N |
| XLogP | 4.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|