C11H17N3O4S2 — CID 104538405
3-[1-(cyclopropylsulfamoylamino)ethyl]benzenesulfonamide (PubChem CID 104538405) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[1-(cyclopropylsulfamoylamino)ethyl]benzenesulfonamide.
| Compound Name | 3-[1-(cyclopropylsulfamoylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104538405 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[1-(cyclopropylsulfamoylamino)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)NC1CC1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-8(13-20(17,18)14-10-5-6-10)9-3-2-4-11(7-9)19(12,15)16/h2-4,7-8,10,13-14H,5-6H2,1H3,(H2,12,15,16) |
| InChIKey | HLSKNJRJWCFDKT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |