C16H18N2O5S2 — CID 51249276
N-[1-(3-sulfamoylphenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 51249276) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[1-(3-sulfamoylphenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-[1-(3-sulfamoylphenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 51249276 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[1-(3-sulfamoylphenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)CCO2)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-11(12-3-2-4-14(9-12)24(17,19)20)18-25(21,22)15-5-6-16-13(10-15)7-8-23-16/h2-6,9-11,18H,7-8H2,1H3,(H2,17,19,20) |
| InChIKey | VMRMTGMYHZLLRU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |