C13H18N4O2S — CID 104955799
3-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 104955799) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104955799 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nn(C)cc1NC(C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H18N4O2S/c1-9(15-13-8-17(3)16-10(13)2)11-5-4-6-12(7-11)20(14,18)19/h4-9,15H,1-3H3,(H2,14,18,19) |
| InChIKey | HLHYELSREASNGQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |