C12H15N3O3S — CID 106833125
2-[(4-cyano-3-methylphenyl)sulfonylamino]-2-methylpropanamide (PubChem CID 106833125) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(4-cyano-3-methylphenyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[(4-cyano-3-methylphenyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 106833125 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(4-cyano-3-methylphenyl)sulfonylamino]-2-methylpropanamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)(C)C(N)=O)ccc1C#N |
| InChI | InChI=1S/C12H15N3O3S/c1-8-6-10(5-4-9(8)7-13)19(17,18)15-12(2,3)11(14)16/h4-6,15H,1-3H3,(H2,14,16) |
| InChIKey | CPVVSWCWSFUORL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |