C10H15ClN4O3S — CID 106098350
3-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106098350) has the molecular formula C10H15ClN4O3S and a molecular weight of 306.78 g/mol. Its IUPAC name is 3-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106098350 |
| Molecular Formula | C10H15ClN4O3S |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NS(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C10H15ClN4O3S/c1-10(2,4-8(12)16)15-19(17,18)6-3-7(11)9(13)14-5-6/h3,5,15H,4H2,1-2H3,(H2,12,16)(H2,13,14) |
| InChIKey | KXATVDNTFWKBAT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |